63224-42-0 Usage
General Description
4,7-Dibromo-2,1,3-benzoselenadiazole is a chemical compound known for its role in organic materials. It is widely incorporated in the structure of many compounds due to its capability to enhance fluorescence. This chemical has two bromine atoms, which provide reactivity for further functionalization and applicability in various chemical reactions. 4,7-Dibromo-2,1,3-benzoselenadiazole has a distinctly high quantum yield for fluorescence, making it beneficial in the development of materials such as light-emitting diodes and photovoltaics. It can also be used in optical and electronic devices due to its distinctive luminescent properties. Its unique structure, featuring selenium and nitrogen, is believed to confer its distinct properties.
Check Digit Verification of cas no
The CAS Registry Mumber 63224-42-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,2,2 and 4 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 63224-42:
(7*6)+(6*3)+(5*2)+(4*2)+(3*4)+(2*4)+(1*2)=100
100 % 10 = 0
So 63224-42-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H2Br2N2Se/c7-3-1-2-4(8)6-5(3)9-11-10-6/h1-2H