632339-23-2 Usage
Uses
Used in Medicinal Chemistry and Drug Development:
4,9,11-trioxatetracyclo[5.3.1.0(2,6).0(8,10)]undecan-3-one is utilized as a key component in medicinal chemistry and drug development. Its unique structure allows it to be a promising candidate for the design and synthesis of new pharmaceuticals, potentially leading to the creation of innovative treatments for various diseases and conditions.
Used in Organic Synthesis:
In the field of organic synthesis, 4,9,11-trioxatetracyclo[5.3.1.0(2,6).0(8,10)]undecan-3-one serves as a valuable building block. It can be modified to produce a range of bioactive compounds, contributing to the development of new chemical entities with potential applications in various industries.
Used in Materials Science and Polymer Chemistry:
4,9,11-trioxatetracyclo[5.3.1.0(2,6).0(8,10)]undecan-3-one may also find applications in materials science and polymer chemistry. Its distinctive molecular structure could be harnessed to engineer novel materials with specific properties, such as improved strength, flexibility, or chemical resistance, which can be beneficial in a wide array of applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 632339-23-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,3,2,3,3 and 9 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 632339-23:
(8*6)+(7*3)+(6*2)+(5*3)+(4*3)+(3*9)+(2*2)+(1*3)=142
142 % 10 = 2
So 632339-23-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H8O4/c9-8-3-2(1-10-8)4-6-7(12-6)5(3)11-4/h2-7H,1H2
