6331-96-0 Usage
Uses
Used in Dye and Pigment Production:
3,4-Dichloroaniline-6-sulfonic acid is used as a key intermediate in the synthesis of various dyes and pigments, contributing to their color properties and stability.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 3,4-Dichloroaniline-6-sulfonic acid is employed as a reagent in the organic synthesis of various medicinal compounds, playing a crucial role in the development of new drugs.
Used in Hair Dye Manufacturing:
3,4-Dichloroaniline-6-sulfonic acid is used as a colorant in hair dyes, providing a range of shades and enhancing the dye's performance.
Used in Organic Synthesis:
As a strong acid, 3,4-Dichloroaniline-6-sulfonic acid is utilized as a reagent in various organic synthesis processes, facilitating the formation of desired chemical products.
Used as a Catalyst in Chemical Reactions:
3,4-Dichloroaniline-6-sulfonic acid is employed as a catalyst to accelerate specific chemical reactions, improving the efficiency and selectivity of the processes.
However, it is important to note that 3,4-Dichloroaniline-6-sulfonic acid is considered harmful if ingested, inhaled, or absorbed through the skin, and can cause irritation and potential severe health effects. Therefore, proper handling and safety precautions are essential when working with this chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 6331-96-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,3 and 1 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6331-96:
(6*6)+(5*3)+(4*3)+(3*1)+(2*9)+(1*6)=90
90 % 10 = 0
So 6331-96-0 is a valid CAS Registry Number.
InChI:InChI=1/C22H16ClN3O2S/c1-13-9-10-19-18(11-13)25-21(28-19)14-5-4-6-15(12-14)24-22(29)26-20(27)16-7-2-3-8-17(16)23/h2-12H,1H3,(H2,24,26,27,29)
6331-96-0Relevant articles and documents
Production method of 3,4-dichloroaniline-6-sulfonic acid
-
Paragraph 0024, (2016/12/26)
The invention provides a production method of 3,4-dichloroaniline-6-sulfonic acid and belongs to the technical field of chemical synthesis. The production method takes 3,4-dichloroaniline and sulfuric acid as raw materials and comprises the following step