63353-00-4 Usage
Uses
Used in Organic Synthesis:
6-Chloro-3-diethylaminomethyl-indole is used as a synthetic intermediate for the preparation of a variety of organic compounds. Its presence in the molecule allows for further functionalization and modification, facilitating the creation of complex organic structures with potential applications in various fields.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 6-Chloro-3-diethylaminomethyl-indole is used as a building block for the development of new drugs. Its unique structure can be incorporated into drug candidates to impart specific biological activities, potentially leading to the discovery of novel therapeutic agents.
Used in Chemical Research:
6-Chloro-3-diethylaminomethyl-indole is also utilized in chemical research as a model compound to study various reaction mechanisms and to develop new synthetic methodologies. Its reactivity and structural features make it an interesting subject for academic and industrial research.
Used in Dye and Pigment Industry:
Due to its indole core and functional groups, 6-Chloro-3-diethylaminomethyl-indole can be used as a precursor in the synthesis of dyes and pigments. Its ability to form colored compounds can be harnessed to create new dyes with specific properties for use in various applications, such as textiles, plastics, and printing inks.
Used in Agrochemical Industry:
In the agrochemical industry, 6-Chloro-3-diethylaminomethyl-indole may be employed as a starting material for the synthesis of active ingredients in pesticides or other agricultural chemicals. Its unique structure could contribute to the development of new compounds with improved efficacy and selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 63353-00-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,3,5 and 3 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 63353-00:
(7*6)+(6*3)+(5*3)+(4*5)+(3*3)+(2*0)+(1*0)=104
104 % 10 = 4
So 63353-00-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H17ClN2/c1-3-16(4-2)9-10-8-15-13-7-11(14)5-6-12(10)13/h5-8,15H,3-4,9H2,1-2H3
