6340-53-0 Usage
Uses
Used in Pharmaceutical Industry:
(3,4,5-trihydroxy-6-methyl-oxan-2-yl) acetate is used as a potential pharmaceutical agent due to its complex structure and the presence of hydroxyl groups, which are common in biologically active molecules. Its potential biological activity and ability to bind to other molecules make it a candidate for drug development and therapeutic applications.
Used in Chemical Research:
(3,4,5-trihydroxy-6-methyl-oxan-2-yl) acetate is used as a subject of chemical research to explore its properties, reactivity, and potential applications. (3,4,5-trihydroxy-6-methyl-oxan-2-yl) acetate's unique structure and functional groups provide opportunities for studying its interactions with other molecules and its behavior under various conditions.
Used in Solubility and Reactivity Studies:
(3,4,5-trihydroxy-6-methyl-oxan-2-yl) acetate is used in studies focused on solubility and reactivity due to the influence of its methyl group and acetate ester. Understanding how these structural elements affect the compound's properties can contribute to the development of new chemical processes and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 6340-53-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,4 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 6340-53:
(6*6)+(5*3)+(4*4)+(3*0)+(2*5)+(1*3)=80
80 % 10 = 0
So 6340-53-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O6/c1-3-5(10)6(11)7(12)8(13-3)14-4(2)9/h3,5-8,10-12H,1-2H3
