6340-53-0 Usage
General Description
(3,4,5-trihydroxy-6-methyl-oxan-2-yl) acetate is a chemical compound that has a complex structure consisting of a ring of carbon and oxygen atoms, with three hydroxyl groups and a methyl group attached to it. The acetate group is also attached to the ring, making it an ester. (3,4,5-trihydroxy-6-methyl-oxan-2-yl) acetate is likely to have biological activity due to the presence of hydroxyl groups, which are common functional groups in many biologically active molecules. The methyl group may also contribute to the compound's properties, as it can affect the compound's solubility and reactivity. Additionally, the acetate ester may make the compound more volatile and enhance its ability to bind to other molecules. Further research and analysis would be needed to fully understand the chemical and biological properties of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 6340-53-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,4 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 6340-53:
(6*6)+(5*3)+(4*4)+(3*0)+(2*5)+(1*3)=80
80 % 10 = 0
So 6340-53-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O6/c1-3-5(10)6(11)7(12)8(13-3)14-4(2)9/h3,5-8,10-12H,1-2H3
