6342-89-8 Usage
Uses
Used in Pharmaceutical Industry:
4-tetralin-1-ylbutanoic acid serves as a crucial building block for the synthesis of a variety of pharmaceuticals. Its unique structure allows it to be a key component in the development of new drugs and therapeutic agents.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, 4-tetralin-1-ylbutanoic acid is utilized in the synthesis of diverse organic compounds, contributing to the creation of complex molecules with specific functions.
Used in Research and Development:
4-tetralin-1-ylbutanoic acid is employed in research and development settings to explore its potential applications and properties. Its presence in the synthesis process aids in the discovery of new drug candidates and therapeutic agents.
Used for Therapeutic Properties:
4-tetralin-1-ylbutanoic acid has demonstrated potential therapeutic properties, such as anti-inflammatory and analgesic effects. These properties make it a valuable compound in the development of treatments for various conditions.
Used in Chemical Industry:
Due to its versatile chemical structure and potential pharmacological properties, 4-tetralin-1-ylbutanoic acid has a broad range of applications within the chemical industry, contributing to the advancement of chemical processes and the creation of novel compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 6342-89-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,4 and 2 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 6342-89:
(6*6)+(5*3)+(4*4)+(3*2)+(2*8)+(1*9)=98
98 % 10 = 8
So 6342-89-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H18O2/c15-14(16)10-4-8-12-7-3-6-11-5-1-2-9-13(11)12/h1-2,5,9,12H,3-4,6-8,10H2,(H,15,16)
