63430-98-8 Usage
Uses
Used in Pharmaceutical Industry:
L-1,2,3,4-Tetrahydro-quinoline-2-carboxylic acid hydrochloride serves as a key building block in the synthesis of a range of drugs and drug candidates. Its unique structure and functional group contribute to the development of potential treatments for neurological disorders, cancer, and other medical conditions.
Used in Drug Discovery and Development:
This chemical compound plays a crucial role in drug discovery and development due to its versatile applications in medicinal chemistry. Its ability to form stable compounds and its solubility in the hydrochloride salt form make it an ideal candidate for use in laboratory settings and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 63430-98-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,4,3 and 0 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 63430-98:
(7*6)+(6*3)+(5*4)+(4*3)+(3*0)+(2*9)+(1*8)=118
118 % 10 = 8
So 63430-98-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NO2.ClH/c12-10(13)9-6-5-7-3-1-2-4-8(7)11-9;/h1-4,9,11H,5-6H2,(H,12,13);1H/t9-;/m0./s1
63430-98-8Relevant academic research and scientific papers
1-[Acylthio) and (mercapto)-1-oxoalkyl]-1,2,3,4-tetrahydroquinoline-2-carboxylic acids
-
, (2008/06/13)
A series of 1-[acylthio) and (mercapto)-1-oxoalkyl]-1,2,3,4-tetrahydroquinoline-2-carboxylic acids and salts thereof are useful as Angiotensin I converting enzyme inhibitors.
