63434-97-9 Usage
Explanation
Different sources of media describe the Explanation of 63434-97-9 differently. You can refer to the following data:
1. The molecular formula represents the number of atoms of each element present in a molecule of the compound.
2. Heterocyclic compound
2. A heterocyclic compound is a cyclic compound that contains atoms of at least two different elements, in this case, carbon, nitrogen, sulfur, and hydrogen.
3. Diazepine group
3. Diazepines are a class of seven-membered ring compounds containing two nitrogen atoms. This compound belongs to this group.
4. Seven-membered ring
4. The compound has a ring structure with seven atoms.
5. Two nitrogen atoms
5. The diazepine ring contains two nitrogen atoms as part of its structure.
6. Two sulfur atoms
6. The compound has two sulfur atoms, which are part of the dithione group.
7. Chemical research and synthesis
7. The compound is used in chemical research and synthesis, indicating its importance in the development of new chemical compounds and reactions.
8. Potential pharmaceutical applications
8. Due to its unique structure and properties, the compound may have potential applications in the pharmaceutical industry, although the exact uses and effects are still under investigation.
9. Further study and development
9. The compound is considered valuable for further study and development in various fields of chemistry and biochemistry, suggesting its potential for future discoveries and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 63434-97-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,4,3 and 4 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 63434-97:
(7*6)+(6*3)+(5*4)+(4*3)+(3*4)+(2*9)+(1*7)=129
129 % 10 = 9
So 63434-97-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H12N2S2/c1-8-4-3-5-9(2)7(11)6(8)10/h3-5H2,1-2H3
