63446-39-9 Usage
General Description
3-Methyl-1,5,6,7-tetrahydroindazol-4-one is a chemical compound with the molecular formula C9H11N3O. It is a heterocyclic compound containing both a nitrogen and an oxygen atom in its ring structure. 3-METHYL-1,5,6,7-TETRAHYDROINDAZOL-4-ONE has potential pharmaceutical applications, as it has been studied for its effects on the central nervous system and as an anti-inflammatory agent. It is also a precursor in the synthesis of various organic compounds. Additionally, 3-Methyl-1,5,6,7-tetrahydroindazol-4-one has been investigated for its potential use in the development of new materials, due to its unique chemical structure and properties. Overall, this chemical compound has potential applications in the fields of medicine, materials science, and organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 63446-39-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,4,4 and 6 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 63446-39:
(7*6)+(6*3)+(5*4)+(4*4)+(3*6)+(2*3)+(1*9)=129
129 % 10 = 9
So 63446-39-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O/c1-5-8-6(10-9-5)3-2-4-7(8)11/h2-4H2,1H3,(H,9,10)