63467-34-5 Usage
Chemical structure
A quaternary ammonium salt consisting of a pyridine ring with a methoxy group at position 1 and a phenyl group at position 4, coupled with an iodide ion.
Usage in organic synthesis
Commonly used as a phase-transfer catalyst in various chemical reactions, facilitating the transfer of reactants between different phases (e.g., solid and liquid) and thus speeding up the reaction process.
Pharmaceutical research
Possesses strong antimicrobial properties, making it a potential candidate for the development of new antibiotics to combat bacterial infections.
Neurodegenerative disease treatment
Has been studied for its potential use in the treatment of neurodegenerative diseases, such as Alzheimer's and Parkinson's, due to its neuroprotective effects on neurons.
Applications in chemistry, medicine, and biotechnology
The compound's versatile properties make it suitable for a wide range of applications across these fields, including drug development, chemical synthesis, and the study of biological processes.
Check Digit Verification of cas no
The CAS Registry Mumber 63467-34-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,4,6 and 7 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 63467-34:
(7*6)+(6*3)+(5*4)+(4*6)+(3*7)+(2*3)+(1*4)=135
135 % 10 = 5
So 63467-34-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H12NO.HI/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11;/h2-10H,1H3;1H/q+1;/p-1
