63476-93-7 Usage
Uses
Used in Organic Synthesis:
4-Formyl benzamidine HCl is used as a reagent in organic synthesis for its ability to participate in various chemical reactions, contributing to the formation of complex organic molecules.
Used in Biochemical and Pharmacological Research:
4-Formyl benzamidine HCl is used as an inhibitor in biochemical and pharmacological research, where it can help in understanding the mechanisms of enzymatic reactions and the development of potential therapeutic agents.
Used in the Preparation of Peptide Mimetics:
4-Formyl benzamidine HCl is used as a key component in the preparation of peptide mimetics, which are compounds that mimic the structure and function of peptides, offering potential applications in drug design and development.
Used as an Intermediate in Pharmaceutical Synthesis:
4-Formyl benzamidine HCl serves as an intermediate in the synthesis of pharmaceuticals, playing a crucial role in the production of various medicinal compounds. Its unique structure allows it to be a valuable building block in the creation of new drugs with specific therapeutic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 63476-93-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,4,7 and 6 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 63476-93:
(7*6)+(6*3)+(5*4)+(4*7)+(3*6)+(2*9)+(1*3)=147
147 % 10 = 7
So 63476-93-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2O.ClH/c9-8(10)7-3-1-6(5-11)2-4-7;/h1-5H,(H3,9,10);1H
63476-93-7Relevant academic research and scientific papers
BLOOD BRAIN BARRIER-PENETRATING OXIMES FOR CHOLISTENERASES REACTIVATION
-
Page/Page column 17, (2012/06/30)
The invention describes pharmaceutical agents capable of crossing the blood brain barrier to protect against organophosphate pesticides and nerve agents or other electrophiles by reactivating inhibited cholinesterase (i.e., acetylcholinesterase and butyrylcholinesterase) and other proteins in the peripheral and central nervous system.
