635-91-6 Usage
Uses
Used in Pharmaceutical Industry:
L-ASPARTIC ACID ALPHA-(BETA-NAPHTHYLAMIDE) is used as a pharmaceutical compound for its potential therapeutic applications. The expression is: L-ASPARTIC ACID ALPHA-(BETA-NAPHTHYLAMIDE) is used as a pharmaceutical compound for its unique chemical properties and potential therapeutic applications.
Used in Research and Development:
In the field of research and development, L-ASPARTIC ACID ALPHA-(BETA-NAPHTHYLAMIDE) is used as a chemical intermediate for the synthesis of various compounds and drugs. The expression is: L-ASPARTIC ACID ALPHA-(BETA-NAPHTHYLAMIDE) is used as a chemical intermediate for its role in the synthesis of various compounds and drugs.
Used in Chemical Synthesis:
L-ASPARTIC ACID ALPHA-(BETA-NAPHTHYLAMIDE) is also utilized in chemical synthesis as a key component in the production of other related compounds. The expression is: L-ASPARTIC ACID ALPHA-(BETA-NAPHTHYLAMIDE) is used as a key component in the production of other related compounds for its unique chemical properties and reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 635-91-6 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,3 and 5 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 635-91:
(5*6)+(4*3)+(3*5)+(2*9)+(1*1)=76
76 % 10 = 6
So 635-91-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H14N2O3/c15-12(8-13(17)18)14(19)16-11-6-5-9-3-1-2-4-10(9)7-11/h1-7,12H,8,15H2,(H,16,19)(H,17,18)
