63564-07-8 Usage
Chemical class
Imino esters
Usage
Organic synthesis and pharmaceutical research
Applications
Development of new drugs and pharmaceutical products
Fields of application
Medicine, agriculture, and materials science
Chemical properties
Unique chemical properties due to its imino ester structure
Biological properties
Potential for various research and industrial purposes
Structure
Contains a 4-methoxyphenyl group attached to an ethyl iminoxyacetic acid backbone
Functional groups
Imino (-NH-), ester (-COO-), and methoxy (-OCH3) groups
Reactivity
May undergo various chemical reactions such as hydrolysis, substitution, and condensation reactions due to its functional groups
Stability
Can be sensitive to certain conditions, such as heat, light, or moisture, depending on its purity and storage conditions
Solubility
Soluble in polar solvents like water, methanol, or ethanol
Purity
Typically synthesized and used in a pure form for research and development purposes
Check Digit Verification of cas no
The CAS Registry Mumber 63564-07-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,5,6 and 4 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 63564-07:
(7*6)+(6*3)+(5*5)+(4*6)+(3*4)+(2*0)+(1*7)=128
128 % 10 = 8
So 63564-07-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO4/c1-8(12-16-7-11(13)14)9-3-5-10(15-2)6-4-9/h3-6H,7H2,1-2H3,(H,13,14)/b12-8+
