63608-33-3 Usage
Uses
Used in Pharmaceutical Industry:
4-(4-CHLORO-PHENOXYMETHYL)-PIPERIDINE is used as a key intermediate compound for the synthesis of various pharmaceuticals with therapeutic properties. Its unique structure allows it to be a building block for developing new drugs that can target specific biological pathways or receptors, potentially leading to more effective treatments for a range of medical conditions.
Used in Drug Development:
In the field of drug development, 4-(4-CHLORO-PHENOXYMETHYL)-PIPERIDINE serves as a valuable starting material for creating novel drug candidates. Its chemical versatility enables researchers to modify its structure to optimize pharmacological activity, selectivity, and safety profiles. This can lead to the discovery of new therapeutic agents with improved efficacy and reduced side effects.
Used in Medicinal Chemistry Research:
4-(4-CHLORO-PHENOXYMETHYL)-PIPERIDINE is also utilized in medicinal chemistry research to explore its potential as a lead compound for the treatment of various diseases. By studying its interactions with biological targets and understanding its mechanism of action, researchers can gain insights into the design of more potent and selective drugs based on its structure.
Check Digit Verification of cas no
The CAS Registry Mumber 63608-33-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,6,0 and 8 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 63608-33:
(7*6)+(6*3)+(5*6)+(4*0)+(3*8)+(2*3)+(1*3)=123
123 % 10 = 3
So 63608-33-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H16ClNO/c13-11-1-3-12(4-2-11)15-9-10-5-7-14-8-6-10/h1-4,10,14H,5-9H2
