63642-41-1 Usage
Uses
Used in Organic Synthesis:
(2-OXOQUINOXALIN-1(2H)-YL)ACETIC ACID is used as a building block in organic synthesis for the creation of other complex molecules. Its versatile structure allows it to be a valuable component in the development of new chemical entities.
Used in Pharmaceutical Research:
In the pharmaceutical industry, (2-OXOQUINOXALIN-1(2H)-YL)ACETIC ACID is investigated for its potential as an antibacterial and antifungal agent. Its ability to target and combat various microbial pathogens makes it a promising candidate for the development of new antimicrobial drugs.
Used in Antioxidant and Anti-inflammatory Research:
(2-OXOQUINOXALIN-1(2H)-YL)ACETIC ACID has also been studied for its potential antioxidant and anti-inflammatory properties. These properties could be harnessed in the development of treatments for various conditions where oxidative stress and inflammation are factors, such as in chronic diseases and inflammatory disorders.
Overall, the diverse applications of (2-OXOQUINOXALIN-1(2H)-YL)ACETIC ACID, ranging from its role in organic synthesis to its potential in pharmaceuticals, highlight its significance in the field of chemistry and medicine. Further research and development are necessary to fully explore and exploit its capabilities.
Check Digit Verification of cas no
The CAS Registry Mumber 63642-41-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,6,4 and 2 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 63642-41:
(7*6)+(6*3)+(5*6)+(4*4)+(3*2)+(2*4)+(1*1)=121
121 % 10 = 1
So 63642-41-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2O3/c13-9-5-11-7-3-1-2-4-8(7)12(9)6-10(14)15/h1-5H,6H2,(H,14,15)
