63689-63-4 Usage
Uses
Used in Chemical and Biological Applications:
2,6-DIKETO-4-THIA-15-CROWN-5 is used as a complexing agent for its ability to bind metal cations, which is crucial in various chemical reactions and biological processes. Its interaction with metal ions can modulate the reactivity and selectivity of these ions, facilitating specific reactions or stabilizing certain molecular structures.
Used in Ion Extraction:
In the field of ion extraction, 2,6-DIKETO-4-THIA-15-CROWN-5 is used as a selective agent for the extraction of metal ions from solutions. Its crown ether structure allows for the selective binding and extraction of specific metal ions, which is essential in processes such as environmental remediation and the purification of metal-containing solutions.
Used in Ion Sensing:
2,6-DIKETO-4-THIA-15-CROWN-5 is utilized as a sensing agent in ion sensing applications. Its ability to bind metal ions can be translated into a measurable signal, such as a change in fluorescence or electrical conductivity, allowing for the detection and quantification of metal ions in various environments.
Used in Metal Ion Separation Processes:
In metal ion separation processes, 2,6-DIKETO-4-THIA-15-CROWN-5 is employed as a separating agent. Its selective binding properties enable the separation of different metal ions, which is vital in applications such as the purification of metal mixtures and the isolation of specific metal ions for further analysis or use.
Used in Drug Delivery Systems:
2,6-DIKETO-4-THIA-15-CROWN-5 is used as a component in drug delivery systems, where its ability to bind metal ions can be leveraged to control the release of therapeutic agents. This can improve the bioavailability and efficacy of drugs, as well as reduce side effects by targeting specific areas within the body.
Used as a Catalyst in Organic Synthesis Reactions:
In the realm of organic synthesis, 2,6-DIKETO-4-THIA-15-CROWN-5 serves as a catalyst, enhancing the rate of chemical reactions. Its metal-binding properties can facilitate or accelerate specific reactions, making it a valuable tool in the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 63689-63-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,6,8 and 9 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 63689-63:
(7*6)+(6*3)+(5*6)+(4*8)+(3*9)+(2*6)+(1*3)=164
164 % 10 = 4
So 63689-63-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H16O6S/c11-9-7-17-8-10(12)16-6-4-14-2-1-13-3-5-15-9/h1-8H2
