63689-65-6 Usage
Uses
Used in Coordination Chemistry:
2,6-DIKETO-4,13-DITHIA-18-CROWN-6 is used as a ligand in coordination chemistry for its ability to selectively bind certain metal ions. This property is useful in the synthesis of metal complexes and the study of their properties and applications.
Used in Supramolecular Chemistry:
In supramolecular chemistry, 2,6-DIKETO-4,13-DITHIA-18-CROWN-6 is used as a building block for the construction of larger supramolecular structures. Its ability to form complexes with metal ions and other cations contributes to the development of new materials and systems with specific functions.
Used in Separation and Extraction Processes:
2,6-DIKETO-4,13-DITHIA-18-CROWN-6 is used as a selective binding agent in separation and extraction processes. Its ability to selectively complex with certain metal ions makes it a valuable tool in the purification and isolation of specific elements from mixtures.
Used in Biomedical Applications:
In the biomedical field, 2,6-DIKETO-4,13-DITHIA-18-CROWN-6 is used as a component in drug delivery systems and imaging agents. Its ability to form complexes with certain ions and molecules allows for the development of targeted therapies and diagnostic tools.
Used in Pharmaceutical Industry:
2,6-DIKETO-4,13-DITHIA-18-CROWN-6 is used as a pharmaceutical excipient for its ability to enhance the solubility and stability of active pharmaceutical ingredients. This improves the bioavailability and effectiveness of drugs in various formulations.
Used in Analytical Chemistry:
In analytical chemistry, 2,6-DIKETO-4,13-DITHIA-18-CROWN-6 is used as a reagent or a component in the development of sensors and assays. Its selective binding properties can be exploited to detect and quantify specific analytes in complex samples.
Check Digit Verification of cas no
The CAS Registry Mumber 63689-65-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,6,8 and 9 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 63689-65:
(7*6)+(6*3)+(5*6)+(4*8)+(3*9)+(2*6)+(1*5)=166
166 % 10 = 6
So 63689-65-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H20O6S2/c13-11-9-20-10-12(14)18-4-2-16-6-8-19-7-5-15-1-3-17-11/h1-10H2
