63700-39-0 Usage
Description
(-)-N2-(6-Methyloctanoyl-L-A2bu-L-Thr-L-A2bu-)cyclo(L-A2bu-L-A2bu-D-Phe-L-Leu-L-A2bu-L-A2bu-L-Leu-) is a cyclic peptide chemical compound composed of various amino acids, such as L-threonine, L-phenylalanine, L-leucine, and 6-methyloctanoyl-L-alanine. (-)-N2-(6-Methyloctanoyl-L-A2bu-L-Thr-L-A2bu-)cyclo(L-A2bu-L-A2bu-D-Phe-L-Leu-L-A2bu-L-A2bu-L-Leu-) exhibits potential biological activity and holds promise for pharmaceutical development. The unique arrangement and sequence of amino acids in this compound may be responsible for its biological properties, and further research is required to explore its full potential and applications.
Uses
Used in Pharmaceutical Development:
(-)-N2-(6-Methyloctanoyl-L-A2bu-L-Thr-L-A2bu-)cyclo(L-A2bu-L-A2bu-D-Phe-L-Leu-L-A2bu-L-A2bu-L-Leu-) is used as a potential pharmaceutical candidate due to its biological activity. The specific sequence and arrangement of amino acids in this compound may contribute to its therapeutic effects, making it a valuable target for further research and development in the pharmaceutical industry.
Used in Drug Discovery:
In the field of drug discovery, (-)-N2-(6-Methyloctanoyl-L-A2bu-L-Thr-L-A2bu-)cyclo(L-A2bu-L-A2bu-D-Phe-L-Leu-L-A2bu-L-A2bu-L-Leu-) serves as a promising lead compound. Its unique structure and potential biological activity make it a valuable starting point for the development of new drugs and therapies, particularly for conditions that may benefit from its specific properties.
Used in Research:
(-)-N2-(6-Methyloctanoyl-L-A2bu-L-Thr-L-A2bu-)cyclo(L-A2bu-L-A2bu-D-Phe-L-Leu-L-A2bu-L-A2bu-L-Leu-) is utilized as a research tool in various scientific studies. Its unique composition and potential biological activity provide researchers with valuable insights into the structure-function relationships of cyclic peptides and their potential applications in medicine and other fields.
Used in Biochemistry and Molecular Biology:
In the fields of biochemistry and molecular biology, (-)-N2-(6-Methyloctanoyl-L-A2bu-L-Thr-L-A2bu-)cyclo(L-A2bu-L-A2bu-D-Phe-L-Leu-L-A2bu-L-A2bu-L-Leu-) is employed as a model compound to study the interactions between peptides and other biomolecules. Understanding these interactions can help researchers develop a deeper understanding of the molecular mechanisms underlying various biological processes and diseases.
Used in Chemical Synthesis:
(-)-N2-(6-Methyloctanoyl-L-A2bu-L-Thr-L-A2bu-)cyclo(L-A2bu-L-A2bu-D-Phe-L-Leu-L-A2bu-L-A2bu-L-Leu-) is also used in chemical synthesis as a precursor or building block for the development of new cyclic peptide-based compounds. Its unique structure and potential biological activity make it a valuable component in the synthesis of novel therapeutic agents and other bioactive molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 63700-39-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,7,0 and 0 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 63700-39:
(7*6)+(6*3)+(5*7)+(4*0)+(3*0)+(2*3)+(1*9)=110
110 % 10 = 0
So 63700-39-0 is a valid CAS Registry Number.
InChI:InChI=1/C58H102N16O12/c1-8-35(6)14-12-13-17-47(76)65-38(18-24-59)55(83)74-48(36(7)75)58(86)70-42(22-28-63)51(79)69-43-23-29-64-49(77)44(30-33(2)3)71-52(80)40(20-26-61)66-50(78)39(19-25-60)68-56(84)45(31-34(4)5)72-57(85)46(32-37-15-10-9-11-16-37)73-53(81)41(21-27-62)67-54(43)82/h9-11,15-16,33-36,38-46,48,75H,8,12-14,17-32,59-63H2,1-7H3,(H,64,77)(H,65,76)(H,66,78)(H,67,82)(H,68,84)(H,69,79)(H,70,86)(H,71,80)(H,72,85)(H,73,81)(H,74,83)