637020-86-1 Usage
Description
(R)-ALPHA-(2-BROMOBENZYL)-PROLINE-HCL is a chemical compound that is a salt form of the amino acid proline, featuring a 2-bromobenzyl group attached to the alpha carbon of the proline molecule. (R)-ALPHA-(2-BROMOBENZYL)-PROLINE-HCL is widely recognized for its utility in organic synthesis and pharmaceutical research, where it serves as a chiral building block for the preparation of various proline-containing compounds. Its HCL salt form enhances stability and ease of handling in laboratory settings, making it a valuable asset in the development of potential drug candidates and bioactive molecules.
Uses
Used in Pharmaceutical Research:
(R)-ALPHA-(2-BROMOBENZYL)-PROLINE-HCL is used as a chiral building block for the synthesis of proline-containing compounds, which are essential in the development of new pharmaceuticals. Its unique structure allows for the creation of enantiomerically pure compounds, a critical factor in ensuring the desired biological activity and minimizing potential side effects.
Used in Organic Synthesis:
In the field of organic synthesis, (R)-ALPHA-(2-BROMOBENZYL)-PROLINE-HCL is employed as a versatile starting material for the preparation of a range of organic compounds. Its 2-bromobenzyl group provides a platform for further chemical reactions, facilitating the synthesis of complex molecules with specific properties and functions.
Used in Drug Development:
(R)-ALPHA-(2-BROMOBENZYL)-PROLINE-HCL is utilized as a starting material for the synthesis of potential drug candidates. Its role in creating proline-containing compounds makes it instrumental in the discovery and development of new therapeutic agents, particularly those targeting specific biological pathways or receptors.
Used in Bioactive Molecule Synthesis:
(R)-ALPHA-(2-BROMOBENZYL)-PROLINE-HCL is also used in the synthesis of bioactive molecules, which are essential for understanding biological processes and developing new treatments for various diseases. The incorporation of (R)-ALPHA-(2-BROMOBENZYL)-PROLINE-HCL into these molecules can enhance their biological activity and selectivity, contributing to advancements in medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 637020-86-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,3,7,0,2 and 0 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 637020-86:
(8*6)+(7*3)+(6*7)+(5*0)+(4*2)+(3*0)+(2*8)+(1*6)=141
141 % 10 = 1
So 637020-86-1 is a valid CAS Registry Number.
InChI:InChI=1/C12H14BrNO2.ClH/c13-10-5-2-1-4-9(10)8-12(11(15)16)6-3-7-14-12;/h1-2,4-5,14H,3,6-8H2,(H,15,16);1H/t12-;/m1./s1
