637020-88-3 Usage
Uses
Used in Pharmaceutical Industry:
(S)-ALPHA-(2-BROMOBENZYL)-PROLINE-HCL is used as a key intermediate in the synthesis of various pharmaceutical compounds for its unique structural and functional attributes. (S)-ALPHA-(2-BROMOBENZYL)-PROLINE-HCL's chirality and the presence of the 2-bromobenzyl group allow for the development of enantioselective drugs, which can exhibit improved efficacy and reduced side effects compared to their racemic counterparts.
Used in Chemical Research:
In the field of chemical research, (S)-ALPHA-(2-BROMOBENZYL)-PROLINE-HCL serves as a valuable tool for studying the effects of chirality on chemical reactions and biological activities. Its unique structure allows researchers to investigate the role of stereochemistry in molecular recognition and interactions, contributing to a deeper understanding of the underlying principles in chemistry and biology.
Used in Catalyst Design:
(S)-ALPHA-(2-BROMOBENZYL)-PROLINE-HCL is utilized as a chiral catalyst in asymmetric synthesis, a technique that enables the production of enantiomerically pure compounds. (S)-ALPHA-(2-BROMOBENZYL)-PROLINE-HCL's specific arrangement of atoms allows it to selectively catalyze reactions, leading to the formation of desired enantiomers with high yields and selectivity. This application is particularly relevant in the synthesis of chiral pharmaceuticals and agrochemicals.
Used in Analytical Chemistry:
In analytical chemistry, (S)-ALPHA-(2-BROMOBENZYL)-PROLINE-HCL can be employed as a chiral derivatizing agent for the enantioselective analysis of chiral compounds. By reacting with chiral analytes, it forms diastereomeric derivatives that can be separated and analyzed using various analytical techniques, such as chromatography and mass spectrometry. This application is crucial for the determination of enantiomeric purity and the study of stereoselective processes in various fields, including pharmaceuticals, environmental science, and food analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 637020-88-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,3,7,0,2 and 0 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 637020-88:
(8*6)+(7*3)+(6*7)+(5*0)+(4*2)+(3*0)+(2*8)+(1*8)=143
143 % 10 = 3
So 637020-88-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H14BrNO2.ClH/c13-10-5-2-1-4-9(10)8-12(11(15)16)6-3-7-14-12;/h1-2,4-5,14H,3,6-8H2,(H,15,16);1H/t12-;/m0./s1