637027-25-9 Usage
Uses
Used in Pharmaceutical Industry:
(R)-PIPERAZINE-2-CARBOXYLIC ACID METHYL ESTER DIHYDROCHLORIDE is used as a reactant for the synthesis of various pharmaceutical compounds. Its dihydrochloride form improves its solubility, which is crucial for the development of effective drug formulations.
Used as a Chelating Agent:
(R)-PIPERAZINE-2-CARBOXYLIC ACID METHYL ESTER DIHYDROCHLORIDE has been studied for its potential use as a chelating agent. Its ability to form complexes with metal ions can be utilized in various applications, such as in the removal of heavy metals from industrial waste or in the stabilization of metal ions in chemical reactions.
Used as an Intermediate in Organic Synthesis:
This chemical serves as an intermediate in the synthesis of other organic compounds. Its unique structure and reactivity make it a valuable building block for the creation of new molecules with potential applications in various industries, including pharmaceuticals, agrochemicals, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 637027-25-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,3,7,0,2 and 7 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 637027-25:
(8*6)+(7*3)+(6*7)+(5*0)+(4*2)+(3*7)+(2*2)+(1*5)=149
149 % 10 = 9
So 637027-25-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H12N2O2.2ClH/c1-10-6(9)5-4-7-2-3-8-5;;/h5,7-8H,2-4H2,1H3;2*1H/t5-;;/m1../s1
