637322-36-2 Usage
General Description
1H-Benzimidazole-1-propanoic acid, 2-ethyl, also known as 1-ethylbenzimidazolylpropanoic acid, is a chemical compound with the molecular formula C14H16N2O2. It is a derivative of benzimidazole and belongs to the class of organic compounds known as phenylpropanoic acids. 1H-Benzimidazole-1-propanoicacid,2-ethyl-(9CI) is commonly used in the synthesis of various pharmaceuticals and exhibits potential biological activities. As a derivative of benzimidazole, it may have applications in medicinal chemistry and drug development. Its specific properties and uses may vary depending on the intended application in different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 637322-36-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,3,7,3,2 and 2 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 637322-36:
(8*6)+(7*3)+(6*7)+(5*3)+(4*2)+(3*2)+(2*3)+(1*6)=152
152 % 10 = 2
So 637322-36-2 is a valid CAS Registry Number.
InChI:InChI=1/C12H14N2O2/c1-2-11-13-9-5-3-4-6-10(9)14(11)8-7-12(15)16/h3-6H,2,7-8H2,1H3,(H,15,16)
