6375-25-3 Usage
Uses
Used in Pharmaceutical Industry:
9,10-Dihydro-2,7-dimethylacridine-3,6-diamine serves as a key intermediate in the synthesis of pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Dye Industry:
As a fluorescent dye, 9,10-dihydro-2,7-dimethylacridine-3,6-diamine is utilized for its light-absorbing and light-emitting properties, making it suitable for various applications in the dye industry.
Used in Organic Electronics:
9,10-Dihydro-2,7-dimethylacridine-3,6-diamine is employed as a building block in the development of organic electronic materials, such as organic light-emitting diodes (OLEDs) and organic solar cells, due to its electronic properties.
Used in Antioxidant Research:
9,10-dihydro-2,7-dimethylacridine-3,6-diamine has been investigated for its potential as an antioxidant, which could have implications for the development of new antioxidants and their applications in various industries.
Used in Drug Development:
9,10-Dihydro-2,7-dimethylacridine-3,6-diamine is also studied for its role in the development of new drugs, indicating its potential as a precursor or active ingredient in future pharmaceutical formulations.
Check Digit Verification of cas no
The CAS Registry Mumber 6375-25-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,7 and 5 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6375-25:
(6*6)+(5*3)+(4*7)+(3*5)+(2*2)+(1*5)=103
103 % 10 = 3
So 6375-25-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H17N3/c1-8-3-14-10(6-12(8)16)5-11-7-13(17)9(2)4-15(11)18-14/h3-4,6-7,18H,5,16-17H2,1-2H3