6375-67-3 Usage
Structure
Thioether derivative of acetic acid with a chloro-methyl phenyl group attached to the thioether sulfur atom
Usage
Potential building block for the synthesis of bioactive molecules in the pharmaceutical industry, possible use as a pesticide or herbicide, and potential industrial applications in the production of polymers or other chemical materials.
Check Digit Verification of cas no
The CAS Registry Mumber 6375-67-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,7 and 5 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 6375-67:
(6*6)+(5*3)+(4*7)+(3*5)+(2*6)+(1*7)=113
113 % 10 = 3
So 6375-67-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H9ClO2S/c1-6-7(10)3-2-4-8(6)13-5-9(11)12/h2-4H,5H2,1H3,(H,11,12)
