63754-83-6 Usage
Uses
Used in Pharmaceutical Industry:
[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methylene]malonic acid is used as a potential pharmaceutical compound for its unique structure and reactivity, which may offer new avenues for drug development and therapeutic applications.
Used in Materials Science:
In the field of materials science, [[4-(2-hydroxyethoxy)-3-methoxyphenyl]methylene]malonic acid is utilized for its potential to contribute to the development of new materials with specific properties, such as improved reactivity or stability, based on its molecular structure.
Check Digit Verification of cas no
The CAS Registry Mumber 63754-83-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,7,5 and 4 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 63754-83:
(7*6)+(6*3)+(5*7)+(4*5)+(3*4)+(2*8)+(1*3)=146
146 % 10 = 6
So 63754-83-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H14O7/c1-19-11-7-8(2-3-10(11)20-5-4-14)6-9(12(15)16)13(17)18/h2-3,6-7,14H,4-5H2,1H3,(H,15,16)(H,17,18)
