63775-95-1 Usage
Uses
Different sources of media describe the Uses of 63775-95-1 differently. You can refer to the following data:
1. Cyclosporin B is a minor analogue of the cyclosporin complex produced by a number of different fungal genera including Trichoderma, Tolypocladium, Fusarium, Nectria and Acremonium. Cyclosporin B possesses immunosuppressant and antifungal activities but has been much less extensively investigated than the major analogue, cyclosporin A.
2. An immunosuppressant that has revolutionized organ transplantation through its use in the prevention of graft rejection.A group of nonpolar cyclic oligopeptides with immunosupppressant activity.
Check Digit Verification of cas no
The CAS Registry Mumber 63775-95-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,7,7 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 63775-95:
(7*6)+(6*3)+(5*7)+(4*7)+(3*5)+(2*9)+(1*5)=161
161 % 10 = 1
So 63775-95-1 is a valid CAS Registry Number.
InChI:InChI=1/C61H109N11O12/c1-25-26-27-39(14)51(74)50-55(78)64-41(16)56(79)66(18)32-47(73)67(19)43(28-33(2)3)54(77)65-48(37(10)11)60(83)68(20)44(29-34(4)5)53(76)62-40(15)52(75)63-42(17)57(80)69(21)45(30-35(6)7)58(81)70(22)46(31-36(8)9)59(82)71(23)49(38(12)13)61(84)72(50)24/h25-26,33-46,48-51,74H,27-32H2,1-24H3,(H,62,76)(H,63,75)(H,64,78)(H,65,77)/b26-25+/t39?,40-,41+,42+,43+,44+,45+,46+,48+,49+,50-,51?/m1/s1