63816-00-2 Usage
General Description
Benzothiazole, 6-methoxy-2,5-dimethyl- (9CI) is a chemical compound with the molecular formula C10H11NOS. It is a derivative of benzothiazole and contains a methoxy group and two methyl groups on the benzene ring. Benzothiazole, 6-methoxy-2,5-dimethyl- (9CI) is commonly used as a building block in the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and dyes. It is also known for its potential biological activities, such as antimicrobial, anti-inflammatory, and antitumor properties. Additionally, it is used in the manufacturing of rubber antioxidants and accelerators. Its precise properties and uses may vary depending on the specific application and formulation.
Check Digit Verification of cas no
The CAS Registry Mumber 63816-00-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,8,1 and 6 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 63816-00:
(7*6)+(6*3)+(5*8)+(4*1)+(3*6)+(2*0)+(1*0)=122
122 % 10 = 2
So 63816-00-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H11NOS/c1-6-4-8-10(5-9(6)12-3)13-7(2)11-8/h4-5H,1-3H3