63816-06-8 Usage
General Description
The chemical 6-chloro-2-[2-(1-ethyl-2,3-dihydro-5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)vinyl]-1,3-diphenyl-1H-imidazo[4,5-b]quinoxalinium perchlorate is a complex organic compound with a quinoxaline core. It contains a chloride ion and a perchlorate ion, making it a perchlorate salt. The molecule also contains an ethyl group, a methyl group, and a phenyl group, all of which contribute to its overall structure and properties. This chemical compound has potential applications in pharmaceuticals, materials science, and organic synthesis due to its unique molecular structure. It may also have biological activity and could be of interest for research and development in the fields of medicine and pharmacology.
Check Digit Verification of cas no
The CAS Registry Mumber 63816-06-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,8,1 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 63816-06:
(7*6)+(6*3)+(5*8)+(4*1)+(3*6)+(2*0)+(1*6)=128
128 % 10 = 8
So 63816-06-8 is a valid CAS Registry Number.
InChI:InChI=1/C35H29ClN6O.ClHO4/c1-3-39-24(2)29(35(43)42(39)28-17-11-6-12-18-28)20-22-32-40(26-13-7-4-8-14-26)33-34(41(32)27-15-9-5-10-16-27)38-31-23-25(36)19-21-30(31)37-33;2-1(3,4)5/h4-23,32H,3H2,1-2H3;(H,2,3,4,5)/b22-20+;