63833-78-3 Usage
General Description
5-[(2-cyano-4-nitrophenyl)azo]-6-[(2-hydroxyethyl)amino]-4-methyl-2-[[3-(2-phenoxyethoxy)propyl]amino]nicotinonitrile is a complex chemical compound that has a unique molecular structure. It contains a nitrophenyl group, a hydroxyethyl amino group, a methyl group, and a nicotinonitrile moiety. Additionally, it comprises a phenoxyethoxypropyl amino group, which contributes to its overall chemical properties. 5-[(2-cyano-4-nitrophenyl)azo]-6-[(2-hydroxyethyl)amino]-4-methyl-2-[[3-(2-phenoxyethoxy)propyl]amino]nicotinonitrile can be used in various applications, including pharmaceuticals, agrochemicals, and materials science, due to its diverse chemical properties and functional groups.
Check Digit Verification of cas no
The CAS Registry Mumber 63833-78-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,8,3 and 3 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 63833-78:
(7*6)+(6*3)+(5*8)+(4*3)+(3*3)+(2*7)+(1*8)=143
143 % 10 = 3
So 63833-78-3 is a valid CAS Registry Number.
InChI:InChI=1/C27H28N8O5/c1-19-23(18-29)26(30-10-5-13-39-14-15-40-22-6-3-2-4-7-22)32-27(31-11-12-36)25(19)34-33-24-9-8-21(35(37)38)16-20(24)17-28/h2-4,6-9,16,36H,5,10-15H2,1H3,(H2,30,31,32)/b34-33+