63858-11-7 Usage
Description
2-(2-Methoxy-phenoxy)-butyric acid, a chemical compound with the molecular formula C12H14O5, is primarily recognized for its pharmaceutical applications. It is a non-steroidal anti-inflammatory drug (NSAID) that effectively treats pain and inflammation by inhibiting prostaglandin synthesis, a critical process in the initiation of these conditions. Beyond its anti-inflammatory role, this compound has also garnered interest for its potential anti-cancer properties, making it a subject of ongoing research. It can be synthesized through various chemical methods and is accessible for research and industrial applications, although further investigation is needed to fully understand its mechanism of action and any possible side effects in humans.
Uses
Used in Pharmaceutical Industry:
2-(2-Methoxy-phenoxy)-butyric acid is used as a non-steroidal anti-inflammatory drug (NSAID) for its ability to alleviate pain and reduce inflammation. It achieves this by inhibiting the synthesis of prostaglandins, which are known to be involved in the inflammatory process and the sensation of pain.
Used in Cancer Research:
In the field of oncology, 2-(2-Methoxy-phenoxy)-butyric acid is being studied for its potential anti-cancer properties. Its role in this area is still under investigation, but the compound's effects on certain biological pathways and its potential to interact with cancer cells are of significant interest to researchers seeking new therapeutic agents for cancer treatment.
Used in Chemical Synthesis:
2-(2-Methoxy-phenoxy)-butyric acid is also utilized in chemical synthesis processes, where it can be transformed into various derivatives for different applications, including the development of new pharmaceuticals and other chemical products. Its versatility in synthesis contributes to its commercial availability for research and industrial purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 63858-11-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,8,5 and 8 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 63858-11:
(7*6)+(6*3)+(5*8)+(4*5)+(3*8)+(2*1)+(1*1)=147
147 % 10 = 7
So 63858-11-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H14O4/c1-3-8(11(12)13)15-10-7-5-4-6-9(10)14-2/h4-8H,3H2,1-2H3,(H,12,13)
