6386-19-7

Usage

Uses

Used in Organic Synthesis:
7-Methoxyl-1-Tetralone is used as an intermediate in organic synthesis for the production of various chemical compounds. Its unique structure allows it to serve as a building block for the creation of more complex molecules, which can be utilized in a wide range of applications, including pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 7-Methoxyl-1-Tetralone is used as a key intermediate in the synthesis of various drugs and drug candidates. Its ability to form a wide range of derivatives makes it a valuable component in the development of new medications with potential therapeutic benefits.
Used in Agrochemical Industry:
7-Methoxyl-1-Tetralone also finds application in the agrochemical industry, where it is used as an intermediate for the synthesis of various agrochemical products, such as pesticides and herbicides. Its versatility in chemical reactions enables the development of new and effective compounds to protect crops and enhance agricultural productivity.
Used in Specialty Chemicals:
In the specialty chemicals sector, 7-Methoxyl-1-Tetralone is employed as a starting material for the synthesis of various specialty chemicals, such as dyes, fragrances, and additives. Its unique properties and reactivity make it an essential component in the development of innovative products with specific applications in various industries.

InChI:InChI=1/C11H12O2/c1-13-9-6-5-8-3-2-4-11(12)10(8)7-9/h5-7H,2-4H2,1H3