63885-21-2 Usage
Molecular structure
Composed of two 3-pyridyl groups and one 2-hydroxyethyl guanidine group
Functional groups
Pyridyl, guanidine, and hydroxyethyl groups
Chelating ligand
Exhibits versatile chelating properties in coordination chemistry
Coordination chemistry
Forms interesting complexes with a variety of metal ions
Catalyst development
Used in the development of new catalysts
Material synthesis
Utilized in the creation of new materials
Medicinal chemistry
Studied for potential applications in drug and pharmaceutical design
Field of study
Chemistry, particularly coordination chemistry and organic synthesis
Check Digit Verification of cas no
The CAS Registry Mumber 63885-21-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,8,8 and 5 respectively; the second part has 2 digits, 2 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 63885-21:
(7*6)+(6*3)+(5*8)+(4*8)+(3*5)+(2*2)+(1*1)=152
152 % 10 = 2
So 63885-21-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H15N5O/c19-8-7-16-13(17-11-3-1-5-14-9-11)18-12-4-2-6-15-10-12/h1-6,9-10,19H,7-8H2,(H2,16,17,18)
