63898-22-6 Usage
Uses
Used in Organic Synthesis:
1,9,16-Heptadecatriene-4,6-diyne-3,8-diol serves as a versatile building block in the synthesis of a wide range of organic compounds and materials. Its long hydrocarbon chain and multiple triple bonds provide opportunities for various chemical reactions, enabling the creation of novel molecules with tailored properties.
Used in Pharmaceutical Development:
Due to its unique structure and functional groups, 1,9,16-Heptadecatriene-4,6-diyne-3,8-diol may possess biological or pharmaceutical properties. Its potential applications in this field could include the development of new drugs or drug candidates, as well as the enhancement of drug delivery systems. Further research is required to explore and confirm its specific properties and reactivity in the context of pharmaceutical applications.
Used in Material Science:
1,9,16-Heptadecatriene-4,6-diyne-3,8-diol's long hydrocarbon backbone and triple bonds may also contribute to its potential use in material science. It could be employed in the development of new materials with specific properties, such as improved strength, flexibility, or chemical resistance. The exploration of its applications in this field would necessitate a deeper understanding of its reactivity and compatibility with other materials.
Check Digit Verification of cas no
The CAS Registry Mumber 63898-22-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,8,9 and 8 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 63898-22:
(7*6)+(6*3)+(5*8)+(4*9)+(3*8)+(2*2)+(1*2)=166
166 % 10 = 6
So 63898-22-6 is a valid CAS Registry Number.
InChI:InChI=1/C17H22O2/c1-3-5-6-7-8-9-10-14-17(19)15-12-11-13-16(18)4-2/h3-4,10,14,16-19H,1-2,5-9H2/b14-10-/t16-,17-/m0/s1
