639-34-9 Usage
Description
(19R)-1-Acetyl-17,19-epoxycuran is a Strychnos alkaloid found in S. psilosperma, which yields colorless crystals from MeOH. It has a specific rotation of [α]22D + 88° and forms a picrate as yellow needles from MeOH with a melting point of 173-5°C. Additionally, it forms a methiodide with a melting point of 301-3°C, and the methoperchlorate begins to decompose at 250°C. The N-oxide of (19R)-1-Acetyl-17,19-epoxycuran forms colorless crystals from Me2CO and has a melting point of 241-3°C.
Uses
Unfortunately, the provided materials do not mention any specific applications or uses for (19R)-1-Acetyl-17,19-epoxycuran. Further research would be needed to determine its potential applications in various industries.
References
Anet, Hughes, Ritchie., Austral. 1. Chem., 6, 58 (1953)
Anet, Robinson.,l. Chem. Soc., 2253 (1955)
Anet., Can. 1. Chem., 883 (1963)
Check Digit Verification of cas no
The CAS Registry Mumber 639-34-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,3 and 9 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 639-34:
(5*6)+(4*3)+(3*9)+(2*3)+(1*4)=79
79 % 10 = 9
So 639-34-9 is a valid CAS Registry Number.
InChI:InChI=1/C21H26N2O2/c1-12-15-10-22-8-7-21-17-5-3-4-6-18(17)23(13(2)24)20(21)16(11-25-12)14(15)9-19(21)22/h3-6,12,14-16,19-20H,7-11H2,1-2H3