6396-90-3 Usage
Explanation
Different sources of media describe the Explanation of 6396-90-3 differently. You can refer to the following data:
1. This is the chemical name of the compound, which is derived from its molecular structure.
2. This is the popular name for the compound, which is used to describe its yellow color and chemical properties.
3. Quinoline yellow is a man-made chemical substance used as a dye to impart a yellow color to various products.
4. The dye is used in multiple industries to color products such as food items, fabrics, and cosmetic products.
5. Quinoline yellow is commonly used as a coloring agent in dairy products to enhance their visual appearance.
6. Some individuals may experience allergic reactions to quinoline yellow, which can range from mild to severe.
7. Due to the potential health risks associated with quinoline yellow, its use in some products has been limited or banned in certain countries.
8. Scientists continue to study the safety and potential risks of quinoline yellow to better understand its impact on human health and inform future regulations.
Type
Synthetic yellow dye
Industries of use
Food, textiles, and cosmetics
Specific applications
Butter, margarine, and other dairy products
Health concerns
Potential to cause allergic reactions
Additional concern
Potential to cause hyperactivity in children
Regulatory status
Restricted use in certain products and countries
Ongoing research
Safety and potential risks
Check Digit Verification of cas no
The CAS Registry Mumber 6396-90-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,9 and 6 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6396-90:
(6*6)+(5*3)+(4*9)+(3*6)+(2*9)+(1*0)=123
123 % 10 = 3
So 6396-90-3 is a valid CAS Registry Number.
InChI:InChI=1/C19H11NO5/c21-14-8-9-3-1-2-4-13(9)20-16(14)15-17(22)11-6-5-10(19(24)25)7-12(11)18(15)23/h1-8,20-21H,(H,24,25)