63990-50-1 Usage
Functional Groups
Hydroxyl group: Suggests potential reactivity and hydrogen bonding capabilities.
Piperazine ring: Indicates potential interaction with neurotransmitter receptors.
Ketone: Signifies potential reactivity and involvement in pharmacological activity.
Utility
Pharmaceutical intermediate: Used in the synthesis of other pharmaceutical compounds.
Potential therapeutic applications: Due to its structure, it may possess medicinal properties.
Pharmacological Potential
Interaction with neurotransmitter receptors: Suggested by the presence of the piperazine ring, indicating possible CNS activity.
Hydrogen bonding capability: Facilitated by the hydroxyl group and ketone, crucial for molecular interactions.
Research and Development
Interest in the pharmaceutical industry: Likely to spur further investigation for potential therapeutic uses.
This compound's structural features and functional groups hint at its pharmacological potential and reactivity, making it a promising candidate for further pharmaceutical research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 63990-50-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,9,9 and 0 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 63990-50:
(7*6)+(6*3)+(5*9)+(4*9)+(3*0)+(2*5)+(1*0)=151
151 % 10 = 1
So 63990-50-1 is a valid CAS Registry Number.
InChI:InChI=1/C22H28N2O3/c1-17-14-19(18(2)25)8-9-22(17)27-16-21(26)15-23-10-12-24(13-11-23)20-6-4-3-5-7-20/h3-9,14,21,26H,10-13,15-16H2,1-2H3