6401-97-4 Usage
Uses
Used in Pharmaceutical Industry:
2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-imine is used as a building block for the synthesis of various pharmaceuticals due to its potential pharmacological activities. Its anti-inflammatory, analgesic, and anti-cancer properties make it a valuable component in the development of new drugs.
Used in Organic Synthesis:
In the field of organic synthesis, 2,4-dihydro-5-methyl-2-phenyl-3H-pyrazol-3-imine is used as a key intermediate for the creation of a wide range of organic molecules. Its unique ring structure and functional groups allow for versatile chemical reactions, contributing to the synthesis of complex organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 6401-97-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,4,0 and 1 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 6401-97:
(6*6)+(5*4)+(4*0)+(3*1)+(2*9)+(1*7)=84
84 % 10 = 4
So 6401-97-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3/c1-8-7-10(11)13(12-8)9-5-3-2-4-6-9/h2-6,11H,7H2,1H3/b11-10+
