6401-98-5 Usage
Description
5-oxo-1-phenyl-2-pyrazoline-3-carboxamide is a heterocyclic chemical compound with a molecular formula of C11H9N3O2. It features a pyrazoline ring, an amide group, and a phenyl group, which contribute to its potential biological activities and applications.
Used in Pharmaceutical Industry:
5-oxo-1-phenyl-2-pyrazoline-3-carboxamide is used as a compound for drug development due to its potential biological activities, including antifungal and antibacterial properties. Its study and development are crucial for creating new drugs to address various health concerns.
Used in Chemical and Industrial Applications:
5-oxo-1-phenyl-2-pyrazoline-3-carboxamide is used as a versatile compound in various chemical and industrial processes. Its unique structure and properties make it a candidate for further research and development in different fields, enhancing its utility and potential impact on various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 6401-98-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,4,0 and 1 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 6401-98:
(6*6)+(5*4)+(4*0)+(3*1)+(2*9)+(1*8)=85
85 % 10 = 5
So 6401-98-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H9N3O2/c11-10(15)8-6-9(14)13(12-8)7-4-2-1-3-5-7/h1-5H,6H2,(H2,11,15)