64028-63-3 Usage
Uses
Used in Polymer Production:
5-NORBORNENE-2-CARBOXYLIC-2-TETRAHYDROFURFURYL ESTER is used as a monomer for the production of polymers, contributing to the creation of materials with specific properties tailored for various applications.
Used in Pharmaceutical and Agrochemical Synthesis:
In the chemical industry, 5-NORBORNENE-2-CARBOXYLIC-2-TETRAHYDROFURFURYL ESTER serves as a chemical intermediate, playing a crucial role in the synthesis of pharmaceuticals and agrochemicals, facilitating the development of new drugs and pesticides.
Used in Adhesives Manufacturing:
5-NORBORNENE-2-CARBOXYLIC-2-TETRAHYDROFURFURYL ESTER is used as a component in the manufacturing of adhesives, enhancing their bonding properties and performance in various industrial and consumer applications.
Used in Sealants Production:
5-NORBORNENE-2-CARBOXYLIC-2-TETRAHYDROFURFURYL ESTER is also utilized in the production of sealants, where it contributes to the formation of durable and reliable sealing materials for construction and industrial use.
Used in Coatings Industry:
5-NORBORNENE-2-CARBOXYLIC-2-TETRAHYDROFURFURYL ESTER is used in the development of coatings, improving their durability, resistance, and performance characteristics for different surfaces.
Used in Advanced Materials Development:
5-NORBORNENE-2-CARBOXYLIC-2-TETRAHYDROFURFURYL ESTER is employed in the research and development of advanced materials, potentially leading to innovations in various fields such as aerospace, automotive, and electronics.
Used in Additives for Industrial Processes:
5-NORBORNENE-2-CARBOXYLIC-2-TETRAHYDROFURFURYL ESTER is also used as an additive in various industrial processes, where it can enhance the efficiency, performance, or quality of the end products.
Check Digit Verification of cas no
The CAS Registry Mumber 64028-63-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,0,2 and 8 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 64028-63:
(7*6)+(6*4)+(5*0)+(4*2)+(3*8)+(2*6)+(1*3)=113
113 % 10 = 3
So 64028-63-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H18O3/c14-13(16-8-11-2-1-5-15-11)12-7-9-3-4-10(12)6-9/h3-4,9-12H,1-2,5-8H2
