64048-94-8 Usage
Uses
Used in Research and Laboratory Settings:
[3-Amino-4-(2-hydroxyethoxy)phenyl]arsine oxide is used as a research compound for its unique properties and potential applications in medicinal chemistry. Its water solubility and organoarsenic nature make it a promising candidate for various chemical and pharmaceutical studies.
Used in Pharmaceutical Development:
In the pharmaceutical industry, [3-Amino-4-(2-hydroxyethoxy)phenyl]arsine oxide is used as a starting material or intermediate in the synthesis of potential drugs. Its unique structure and properties may contribute to the development of novel therapeutic agents.
Used in Aqueous Systems:
Due to its water solubility, [3-Amino-4-(2-hydroxyethoxy)phenyl]arsine oxide is used as a reagent in aqueous systems, where its organoarsenic nature can be exploited for various chemical reactions and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 64048-94-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,0,4 and 8 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 64048-94:
(7*6)+(6*4)+(5*0)+(4*4)+(3*8)+(2*9)+(1*4)=128
128 % 10 = 8
So 64048-94-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H10AsNO3/c10-7-5-6(9-12)1-2-8(7)13-4-3-11/h1-2,5,11H,3-4,10H2
