64074-25-5 Usage
Explanation
Different sources of media describe the Explanation of 64074-25-5 differently. You can refer to the following data:
1. The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 8 carbon (C), 8 hydrogen (H), 4 nitrogen (N), and 2 oxygen (O) atoms.
2. The structure of the compound is based on a 1,2,4-triazole ring, which is a five-membered ring containing three nitrogen atoms and two carbon atoms. The compound also has a carboxylic acid group (-COOH) at the 3rd position of the triazole ring, a cyanomethyl group (-CN-CH2-) attached to the 1st position, and a methyl ester group (-OCH3) attached to the carboxylic acid.
3. The compound is a derivative of 1,2,4-triazole, which is a five-membered ring compound containing three nitrogen atoms and two carbon atoms.
4. This chemical is commonly used in pharmaceutical research due to its potential medicinal properties and its structure.
5. The compound is known for its potential medicinal properties, making it a promising candidate for the development of new drugs.
6. It is important to handle this compound with caution, as it may have potential hazards if not used properly. This could include risks associated with exposure, ingestion, or inhalation, as well as potential environmental or health risks.
7. The compound is classified as a heterocyclic compound, which refers to a cyclic compound that contains atoms of at least two different elements, in this case, carbon, hydrogen, nitrogen, and oxygen.
Structure
1H-1,2,4-Triazole-3-carboxylic acid, 1-(cyanomethyl)-, methyl ester
Derivative of 1,2,4-Triazole
Yes
Pharmaceutical Research
Commonly used
Potential Medicinal Properties
Yes
Hazards
Potential hazards if not used properly
Chemical Classification
Heterocyclic compound
Check Digit Verification of cas no
The CAS Registry Mumber 64074-25-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,0,7 and 4 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 64074-25:
(7*6)+(6*4)+(5*0)+(4*7)+(3*4)+(2*2)+(1*5)=115
115 % 10 = 5
So 64074-25-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4O2/c1-12-6(11)5-8-4-10(9-5)3-2-7/h4H,3H2,1H3
64074-25-5Relevant articles and documents
NOVEL FERROPORTIN INHIBITORS
-
Page/Page column 276, (2017/05/10)
The invention relates to novel ferroportin inhibitors of the general formula (I) pharmaceutical compositions comprising them and the use thereof as medicaments, in particular for the prophylaxis and/or treatment of diseases caused by a lack of hepcidin or iron metabolism disorders, such as particularly iron overload states such as in particular thalassemia and hemochromatosis.