64086-95-9 Usage
General Description
1-amino-2-bromo-4-[[4-[(1-methylethyl)amino]-6-phenyl-1,3,5-triazin-2-yl]amino]anthraquinone is a complex chemical compound with a long and specific name. It is composed of several functional groups, including an amino group, a bromo group, and an anthraquinone core. The presence of these functional groups suggests that this compound may have various potential uses, such as in pharmaceuticals, dyes, or organic synthesis. However, due to its complex structure, further research and testing would be needed to fully understand its properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 64086-95-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,0,8 and 6 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 64086-95:
(7*6)+(6*4)+(5*0)+(4*8)+(3*6)+(2*9)+(1*5)=139
139 % 10 = 9
So 64086-95-9 is a valid CAS Registry Number.
InChI:InChI=1/C26H21BrN6O2/c1-13(2)29-25-31-24(14-8-4-3-5-9-14)32-26(33-25)30-18-12-17(27)21(28)20-19(18)22(34)15-10-6-7-11-16(15)23(20)35/h3-13H,28H2,1-2H3,(H2,29,30,31,32,33)