64086-96-0 Usage
Functional groups
acetyl group, amino group, triazine ring
Potential applications
pharmaceutical industry, dye industry
Structure suggests potential biological activity
Potential target for further research in medicinal chemistry
Check Digit Verification of cas no
The CAS Registry Mumber 64086-96-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,0,8 and 6 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 64086-96:
(7*6)+(6*4)+(5*0)+(4*8)+(3*6)+(2*9)+(1*6)=140
140 % 10 = 0
So 64086-96-0 is a valid CAS Registry Number.
InChI:InChI=1/C28H24N6O3/c1-14(2)30-27-32-26(16-9-5-4-6-10-16)33-28(34-27)31-20-13-19(15(3)35)23(29)22-21(20)24(36)17-11-7-8-12-18(17)25(22)37/h4-14H,29H2,1-3H3,(H2,30,31,32,33,34)