6410-35-1 Usage
Description
4-[(2,5-dichlorophenyl)azo]-3-hydroxy-N-(4-methylphenyl)naphthalene-2-carboxamide is a complex organic chemical compound characterized by a naphthalene core, a carboxamide group, an azo dye moiety, a hydroxyl group, and a 4-methylphenyl group. 4-[(2,5-dichlorophenyl)azo]-3-hydroxy-N-(4-methylphenyl)naphthalene-2-carboxamide is known for its aromatic nature and potential biological activity, making it a valuable subject for research in chemistry, materials science, pharmacology, and medicinal chemistry.
Uses
Used in Dye Industry:
4-[(2,5-dichlorophenyl)azo]-3-hydroxy-N-(4-methylphenyl)naphthalene-2-carboxamide is used as a dye in various applications due to its unique color properties and chemical stability. Its ability to impart color to different materials makes it suitable for use in industries such as textiles, plastics, and printing inks.
Used in Pharmaceutical Industry:
Due to its potential biological activity, 4-[(2,5-dichlorophenyl)azo]-3-hydroxy-N-(4-methylphenyl)naphthalene-2-carboxamide may be utilized in the development of pharmaceuticals. Its unique structure could be harnessed for the creation of new drugs or as intermediates in the synthesis of medicinal compounds.
Used in Organic Synthesis:
4-[(2,5-dichlorophenyl)azo]-3-hydroxy-N-(4-methylphenyl)naphthalene-2-carboxamide serves as a valuable building block in organic synthesis. Its complex structure allows for further chemical modifications, making it a useful precursor for the synthesis of other organic compounds with potential applications in various fields.
Used in Research and Development:
4-[(2,5-dichlorophenyl)azo]-3-hydroxy-N-(4-methylphenyl)naphthalene-2-carboxamide's unique structure and properties make it an interesting target for research and development in chemistry and materials science. It can be used to study the effects of structural modifications on the properties of organic compounds and to explore new methods for the synthesis of complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 6410-35-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,4,1 and 0 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 6410-35:
(6*6)+(5*4)+(4*1)+(3*0)+(2*3)+(1*5)=71
71 % 10 = 1
So 6410-35-1 is a valid CAS Registry Number.
InChI:InChI=1/C24H17Cl2N3O2/c1-14-6-9-17(10-7-14)27-24(31)19-12-15-4-2-3-5-18(15)22(23(19)30)29-28-21-13-16(25)8-11-20(21)26/h2-13,28H,1H3,(H,27,31)/b29-22-