6411-56-9 Usage
Uses
Used in Pharmaceutical Industry:
1-(2,5-disulphophenyl)-4,5-dihydro-5-oxo-1H-pyrazole-3-carboxylic acid is used as an intermediate in the synthesis of other organic compounds and pharmaceuticals. Its unique chemical structure and properties make it a valuable component in the development of new drugs and therapeutic agents.
Used in Research Applications:
1-(2,5-disulphophenyl)-4,5-dihydro-5-oxo-1H-pyrazole-3-carboxylic acid is used as a research compound for studying its potential biological and pharmacological activities. Its anti-inflammatory and antibacterial properties are of particular interest, as they may lead to the discovery of new treatments for various diseases and conditions.
Used in Chemical Synthesis:
1-(2,5-disulphophenyl)-4,5-dihydro-5-oxo-1H-pyrazole-3-carboxylic acid is used as a building block in the synthesis of other organic compounds. Its versatile chemical structure allows it to be incorporated into a wide range of molecules, making it a valuable tool in the field of organic chemistry.
Used in Water Treatment:
Due to its water-solubility, 1-(2,5-disulphophenyl)-4,5-dihydro-5-oxo-1H-pyrazole-3-carboxylic acid can be used in water treatment processes. Its ability to dissolve in water makes it suitable for applications such as water purification and the removal of contaminants.
Used in Material Science:
1-(2,5-disulphophenyl)-4,5-dihydro-5-oxo-1H-pyrazole-3-carboxylic acid can be used in the development of new materials with unique properties. Its chemical structure and functional groups may contribute to the creation of materials with specific characteristics, such as improved stability or enhanced reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 6411-56-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,4,1 and 1 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6411-56:
(6*6)+(5*4)+(4*1)+(3*1)+(2*5)+(1*6)=79
79 % 10 = 9
So 6411-56-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H12ClN3S/c14-11-2-1-3-12(8-11)17-13(18)16-9-10-4-6-15-7-5-10/h1-8H,9H2,(H2,16,17,18)
