64128-26-3 Usage
Description
1-(4-PROPYLPHENYL)ETHAN-1-ONE OXIME is a chemical compound with the molecular formula C11H15NO. It is a type of oxime, which is a functional group containing a nitrogen atom attached to a carbon-oxygen double bond. 1-(4-PROPYLPHENYL)ETHAN-1-ONE OXIME is often used in organic chemistry research and as a reagent in various chemical reactions. It may also have potential applications in the pharmaceutical industry, although further research is needed to fully understand its properties and potential uses. Additionally, it is important to handle this chemical with care, as with any chemical compound, and to follow proper safety protocols when working with it.
Uses
Used in Organic Chemistry Research:
1-(4-PROPYLPHENYL)ETHAN-1-ONE OXIME is used as a research compound for studying organic chemistry and its various reactions.
Used in Chemical Reactions:
1-(4-PROPYLPHENYL)ETHAN-1-ONE OXIME is used as a reagent in various chemical reactions, contributing to the synthesis of different organic compounds.
Used in Pharmaceutical Industry (Potential):
1-(4-PROPYLPHENYL)ETHAN-1-ONE OXIME may have potential applications in the pharmaceutical industry, although further research is needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 64128-26-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,1,2 and 8 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 64128-26:
(7*6)+(6*4)+(5*1)+(4*2)+(3*8)+(2*2)+(1*6)=113
113 % 10 = 3
So 64128-26-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO/c1-3-4-10-5-7-11(8-6-10)9(2)12-13/h5-8,13H,3-4H2,1-2H3/b12-9+
