6417-19-2 Usage
Uses
Used in Dye Industry:
4-[[4-(1-naphthylazo)-1-naphthyl]azo]naphthalen-1-amine is used as a dye for its color properties and solubility in various solvents. Its good light fastness and heat resistance make it suitable for use in various applications, such as textiles, plastics, and printing inks.
Used in Analytical Chemistry:
4-[[4-(1-naphthylazo)-1-naphthyl]azo]naphthalen-1-amine can be used as a reagent in analytical chemistry due to its color-changing properties in the presence of different substances. Its solubility in various solvents and stability in different conditions make it a valuable tool for detecting and analyzing various compounds.
Used in Research and Development:
4-[[4-(1-naphthylazo)-1-naphthyl]azo]naphthalen-1-amine can be used in research and development for the synthesis of new compounds and materials. Its unique properties and reactivity can be utilized to create new dyes, pigments, and other specialty chemicals.
Used in Pharmaceutical Industry:
4-[[4-(1-naphthylazo)-1-naphthyl]azo]naphthalen-1-amine can be used in the pharmaceutical industry for the development of new drugs and drug delivery systems. Its unique chemical structure and properties can be utilized to create new drug candidates or improve the delivery and efficacy of existing drugs.
Preparation
Naphthalen-1-amine diazotization, and Naphthalen-1-amine coupling, product to diazotization, and Naphthalen-1-amine coupling.
Standard
Light Fastness
Melting point
Stable
ISO
Good
Check Digit Verification of cas no
The CAS Registry Mumber 6417-19-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,4,1 and 7 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 6417-19:
(6*6)+(5*4)+(4*1)+(3*7)+(2*1)+(1*9)=92
92 % 10 = 2
So 6417-19-2 is a valid CAS Registry Number.
InChI:InChI=1/C30H21N5/c31-26-16-17-28(23-12-4-3-11-22(23)26)33-35-30-19-18-29(24-13-5-6-14-25(24)30)34-32-27-15-7-9-20-8-1-2-10-21(20)27/h1-19H,31H2/b34-32+,35-33+