642-91-1 Usage
Uses
Used in Pharmaceutical Industry:
2,1-Benzisoxazole-3-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceuticals for its potential therapeutic applications. Its presence in drug molecules contributes to their pharmacological properties, such as anticonvulsant and anti-inflammatory effects.
Used in Organic Synthesis:
2,1-Benzisoxazole-3-carboxylic acid is used as a versatile building block in organic synthesis due to the reactivity of its carboxylic acid group. This allows for the formation of various derivatives and functionalized compounds, expanding its applications in the development of new organic compounds.
Used in Antibacterial Applications:
2,1-Benzisoxazole-3-carboxylic acid is used as an antibacterial agent, exhibiting significant activity against various bacterial strains. Its incorporation into antimicrobial agents can potentially enhance their efficacy in combating bacterial infections.
Used in Anticancer Applications:
2,1-Benzisoxazole-3-carboxylic acid is used as an anticancer agent, showing promising results in inhibiting the growth and proliferation of cancer cells. Its potential to target various cancer types and enhance the effectiveness of existing chemotherapeutic drugs makes it a valuable compound in cancer research and treatment.
Check Digit Verification of cas no
The CAS Registry Mumber 642-91-1 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,4 and 2 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 642-91:
(5*6)+(4*4)+(3*2)+(2*9)+(1*1)=71
71 % 10 = 1
So 642-91-1 is a valid CAS Registry Number.
InChI:InChI=1/C8H5NO3/c10-8(11)7-5-3-1-2-4-6(5)9-12-7/h1-4H,(H,10,11)
