642075-18-1 Usage
Uses
Used in Organic Synthesis:
ETHYL-(1-METHYL-1 H-IMIDAZOL-2-YLMETHYL)-AMINE is used as a building block in organic synthesis for the creation of complex organic molecules. Its unique structure allows for versatile chemical reactions, making it a valuable component in the synthesis of a wide range of compounds.
Used in Pharmaceutical Production:
In the pharmaceutical industry, ETHYL-(1-METHYL-1 H-IMIDAZOL-2-YLMETHYL)-AMINE is used as an intermediate compound in the development of new drugs. Its imidazole structure is often found in various drug molecules, contributing to their biological activity and therapeutic effects.
Used in Agrochemical Production:
ETHYL-(1-METHYL-1 H-IMIDAZOL-2-YLMETHYL)-AMINE is also utilized in the agrochemical sector as a precursor for the synthesis of pesticides and other agricultural chemicals. Its chemical properties make it suitable for the development of effective and targeted agrochemicals.
Used in Polymer Production:
In the polymer industry, ETHYL-(1-METHYL-1 H-IMIDAZOL-2-YLMETHYL)-AMINE is used in the synthesis of polymers with specific properties. Its incorporation into polymer structures can enhance their performance and expand their range of applications.
Used as a Chemical Reaction Reagent:
ETHYL-(1-METHYL-1 H-IMIDAZOL-2-YLMETHYL)-AMINE is employed as a reagent in various chemical reactions, facilitating the formation of desired products and improving the efficiency of the reaction processes. Its versatility in chemical reactions makes it an indispensable tool in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 642075-18-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,4,2,0,7 and 5 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 642075-18:
(8*6)+(7*4)+(6*2)+(5*0)+(4*7)+(3*5)+(2*1)+(1*8)=141
141 % 10 = 1
So 642075-18-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H13N3/c1-3-8-6-7-9-4-5-10(7)2/h4-5,8H,3,6H2,1-2H3
642075-18-1Relevant academic research and scientific papers
SORDARIN DERIVATIVES FOR PREVENTING OR TREATING INFECTIOUS DISEASES CAUSED BY PATHOGENIC MICROORGANISMS
-
Page/Page column 99; 117, (2009/12/05)
This invention relates to a new sordarin derivative or a pharmaceutically acceptable salt thereof, which has antimicrobial activities (especially, antifungal activities), to process for preparation thereof, to a pharmaceutical composition comprising the same, and to a method for prophylactic and/or therapeutic treatment of infectious diseases in a human being or an animal.
