64306-56-5 Usage
Chemical class
Pyridine compounds
Structural feature
Benzoyl group attached to the pyridine ring
Usage
Organic synthesis, medicinal chemistry, potential pharmacological activities, drug development, coordination chemistry, and material development
Unique properties
Valuable building block for the synthesis of various organic molecules, used as a ligand in coordination chemistry, and in the development of new materials.
Check Digit Verification of cas no
The CAS Registry Mumber 64306-56-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,3,0 and 6 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 64306-56:
(7*6)+(6*4)+(5*3)+(4*0)+(3*6)+(2*5)+(1*6)=115
115 % 10 = 5
So 64306-56-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H13NO3/c1-17-10-6-7-13(18-2)11(9-10)14(16)12-5-3-4-8-15-12/h3-9H,1-2H3
